CAS 71267-16-8

3-Chloro-N-(4-nitrophenyl)benzamide

Description:

3-Chloro-N-(4-nitrophenyl)benzamide is an organic compound characterized by its aromatic structure, which includes a benzamide moiety substituted with a chlorine atom and a nitrophenyl group. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and solubility. The nitrophenyl substituent, containing a nitro group (-NO2), is known for its electron-withdrawing properties, which can affect the compound's electronic characteristics and potential applications in various chemical reactions. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties make it of interest in fields such as medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety considerations should be taken into account due to the presence of chlorine and nitro groups, which can pose health risks. Proper handling and disposal methods are essential when working with this compound in a laboratory setting.

Formula: C₁₃H₉ClN₂O₃

InChI: InChI=1S/C13H9ClN2O3/c14-10-3-1-2-9(8-10)13(17)15-11-4-6-12(7-5-11)16(18)19/h1-8H,(H,15,17)

InChI key: InChIKey=CVTNPYYWMAHISD-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(N(=O)=O)C=C1)(=O)C2=CC(Cl)=CC=C2

Synonyms:

• Benzanilide, 3-chloro-4′-nitro-
• benzamide, 3-chloro-N-(4-nitrophenyl)-
• 3-Chloro-N-(4-nitrophenyl)benzamide