CAS 71271-62-0
:α,6-Dimethyl-2-pyridineethanamine
Description:
α,6-Dimethyl-2-pyridineethanamine, with the CAS number 71271-62-0, is an organic compound characterized by its pyridine ring and amine functional group. This compound features a six-membered aromatic ring with two methyl groups attached at the alpha and sixth positions, contributing to its unique structural properties. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the amine group suggests that it can act as a base and participate in hydrogen bonding, which may influence its solubility in polar and non-polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for potential interactions with various biological targets, which could lead to applications in drug development. Safety data should be consulted for handling and storage, as amines can be reactive and may pose health risks if not managed properly. Overall, α,6-Dimethyl-2-pyridineethanamine is a compound with notable chemical properties and potential applications in various fields.
Formula:C9H14N2
InChI:InChI=1/C9H14N2/c1-7(10)6-9-5-3-4-8(2)11-9/h3-5,7H,6,10H2,1-2H3
InChI key:InChIKey=JFGRQKKIRKOYSB-UHFFFAOYSA-N
SMILES:C(C(C)N)C=1N=C(C)C=CC1
Synonyms:- α,6-Dimethyl-2-pyridineethanamine
- 1-(6-Methylpyridin-2-yl)propan-2-amine
- 2-Pyridineethanamine, α,6-dimethyl-
- 1-Methyl-2-(6-methyl-pyridin-2-yl)-ethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
