CAS 71274-38-9

N-(benzylcarbamoyl)-beta-alanine

Description:

N-(Benzylcarbamoyl)-beta-alanine, with the CAS number 71274-38-9, is an organic compound that features a beta-alanine backbone modified with a benzylcarbamoyl group. This compound is characterized by its amide functional group, which contributes to its potential as a bioactive molecule. The presence of the benzyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Beta-alanine itself is a non-essential amino acid known for its role in the synthesis of carnosine, a dipeptide that acts as a buffer in muscle tissue. The modification of beta-alanine with a benzylcarbamoyl moiety may impart unique pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Overall, N-(benzylcarbamoyl)-beta-alanine represents a structurally interesting compound with potential implications in various fields, including biochemistry and pharmaceuticals.

Formula: C₁₁H₁₄N₂O₃

InChI: InChI=1/C11H14N2O3/c14-10(15)6-7-12-11(16)13-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,14,15)(H2,12,13,16)

SMILES: c1ccc(cc1)CNC(=NCCC(=O)O)O

Synonyms:

• 3-{[(Benzylamino)Carbonyl]Amino}Propanoic Acid

3-{[(BENZYLAMINO)CARBONYL]AMINO}PROPANOIC ACID

CAS: 71274-38-9

Formula: C₁₁H₁₄N₂O₃

Purity: 96%

Molecular weight: 222.2405

Ref: IN-DA00FHE1

3-[(benzylcarbamoyl)amino]propanoic acid

CAS: 71274-38-9

Purity: 97%

Molecular weight: 222.24400329589844

Ref: 10-F658547

3-[(Benzylcarbamoyl)amino]propanoic acid

CAS: 71274-38-9

Versatile small molecule scaffold

Formula: C₁₁H₁₄N₂O₃

Purity: Min. 95%

Molecular weight: 222.24 g/mol

Ref: 3D-WCA27438