CAS 71274-84-5
:4-(Trifluoromethoxy)biphenyl
Description:
4-(Trifluoromethoxy)biphenyl, with the CAS number 71274-84-5, is an organic compound characterized by the presence of a biphenyl structure substituted with a trifluoromethoxy group at the para position. This compound typically exhibits a high degree of lipophilicity due to the trifluoromethoxy group, which can influence its solubility and reactivity. The trifluoromethoxy group is known for its electron-withdrawing properties, which can affect the electronic characteristics of the biphenyl moiety, potentially enhancing its stability and altering its reactivity in various chemical reactions. Additionally, the presence of fluorine atoms can impart unique physical properties, such as increased thermal stability and resistance to oxidation. 4-(Trifluoromethoxy)biphenyl may find applications in materials science, pharmaceuticals, and as an intermediate in organic synthesis, where its specific electronic and steric properties can be advantageous. As with many fluorinated compounds, considerations regarding environmental impact and toxicity are important in its handling and application.
Formula:C13H9F3O
InChI:InChI=1/C13H9F3O/c14-13(15,16)17-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H
SMILES:c1ccc(cc1)c1ccc(cc1)OC(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
