CAS 7128-79-2

3-(Acetyloxy)-N-(2-methoxyphenyl)-2-naphthalenecarboxamide

Description:

3-(Acetyloxy)-N-(2-methoxyphenyl)-2-naphthalenecarboxamide, with the CAS number 7128-79-2, is a synthetic organic compound characterized by its complex structure, which includes a naphthalene moiety, an acetyloxy group, and a methoxyphenyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its amide functional group, which can influence interactions with biological targets. The presence of the methoxy group may enhance lipophilicity, affecting its pharmacokinetic properties. Additionally, the acetyloxy group can provide stability and influence reactivity, making it a candidate for various chemical reactions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values. Overall, this compound represents a class of organic molecules that may exhibit interesting biological activities and chemical reactivity.

Formula: C₂₀H₁₇NO₄

InChI: InChI=1S/C20H17NO4/c1-13(22)25-19-12-15-8-4-3-7-14(15)11-16(19)20(23)21-17-9-5-6-10-18(17)24-2/h3-12H,1-2H3,(H,21,23)

InChI key: InChIKey=RKCVQLUEWCVWTN-UHFFFAOYSA-N

SMILES: C(NC1=C(OC)C=CC=C1)(=O)C=2C(OC(C)=O)=CC3=C(C2)C=CC=C3

Synonyms:

• 2-(N-(o-Methoxyphenyl)carbamoyl)-3-naphthyl acetate
• 2-Naphth-o-anisidide, 3-hydroxy-, acetate
• 2-Naphthalenecarboxamide, 3-(acetyloxy)-N-(2-methoxyphenyl)-
• 3-(Acetyloxy)-N-(2-methoxyphenyl)-2-naphthalenecarboxamide
• 3-[(2-Methoxyphenyl)Carbamoyl]Naphthalen-2-Yl Acetate

Naphthol AS-OL acetate

CAS: 7128-79-2

Modified naphtol AS substrate used in histochemical and cytochemical staining

Purity: Min. 95%

Molecular weight: 335.35 g/mol

Ref: 3D-EN68082