CAS 71292-82-5

1-(3,5-difluoro-4-methoxyphenyl)propan-1-one

Description:

1-(3,5-Difluoro-4-methoxyphenyl)propan-1-one, with the CAS number 71292-82-5, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The presence of the difluoro and methoxy groups on the phenyl ring significantly influences its chemical properties, including its reactivity and polarity. The difluoro substituents enhance the electron-withdrawing characteristics of the aromatic system, which can affect the compound's stability and interaction with nucleophiles. The methoxy group, being an electron-donating group, can also influence the compound's reactivity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the functional groups present and the overall molecular structure.

Formula: C₁₀H₁₀F₂O₂

InChI: InChI=1/C10H10F2O2/c1-3-9(13)6-4-7(11)10(14-2)8(12)5-6/h4-5H,3H2,1-2H3

SMILES: CCC(=O)c1cc(c(c(c1)F)OC)F

Synonyms:

• 1-Propanone, 1-(3,5-Difluoro-4-Methoxyphenyl)-
• 1-(3,5-Difluoro-4-methoxyphenyl)propan-1-one

3',5'-Difluoro-4'-methoxypropiophenone

CAS: 71292-82-5

3',5'-Difluoro-4'-methoxypropiophenone

Purity: 97%

Color and Shape: Low-Melting Solid

Molecular weight: 200.18g/mol

Ref: 54-PC2848