CAS 71295-28-8

(14aR,14bR)-6-hydroxy-3,4,5-trimethyl-3,4,5,6,9,11,13,14,14a,14b-decahydro[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione

Description:

The chemical substance known as "(14aR,14bR)-6-hydroxy-3,4,5-trimethyl-3,4,5,6,9,11,13,14,14a,14b-decahydro[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione" with CAS number 71295-28-8 is a complex organic compound characterized by its unique bicyclic structure, which includes multiple fused rings and functional groups. This compound features a hydroxyl group (-OH) that contributes to its reactivity and potential biological activity. The presence of multiple methyl groups indicates a degree of hydrophobicity, which can influence its solubility and interaction with biological membranes. The dioxacyclododecino structure suggests that it may participate in various chemical reactions, including those involving ring-opening or rearrangement. Its stereochemistry, denoted by the (14aR,14bR) configuration, implies specific spatial arrangements that can affect its pharmacological properties. Overall, this compound may have applications in medicinal chemistry or as a synthetic intermediate, although specific biological activities and practical uses would require further investigation and characterization.

Formula: C₁₇H₂₅NO₅

InChI: InChI=1/C17H25NO5/c1-9-10(2)15(19)17(21)22-8-12-4-6-18-7-5-13(14(12)18)23-16(20)11(9)3/h4,9-11,13-15,19H,5-8H2,1-3H3/t9?,10?,11?,13-,14-,15?/m1/s1

SMILES: CC1C(C)C(C(=O)OCC2=CCN3CC[C@H]([C@@H]23)OC(=O)C1C)O

Crotananine

CAS: 71295-28-8

Formula: C₁₇H₂₅NO₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 323.389

Ref: BP-BPC0366

Crotananine

CAS: 71295-28-8

Please enquire for more information about Crotananine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₂₅NO₅

Purity: Min. 95%

Molecular weight: 323.40 g/mol

Ref: 3D-WCA29528