CAS 71295-34-6
:2,2,2-trifluoro-N-[(7S)-10-hydroxy-1,2,3-trimethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]acetamide
Description:
2,2,2-Trifluoro-N-[(7S)-10-hydroxy-1,2,3-trimethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]acetamide is a complex organic compound characterized by its unique structural features, including a trifluoroacetamide group and a tetrahydrobenzo[a]heptalene moiety. The presence of trifluoromethyl groups typically enhances the lipophilicity and metabolic stability of the compound, which may influence its biological activity. The compound also contains multiple methoxy groups, which can affect solubility and reactivity. The hydroxyl group contributes to potential hydrogen bonding interactions, enhancing its solubility in polar solvents. This compound may exhibit interesting pharmacological properties due to its structural complexity, making it a candidate for further investigation in medicinal chemistry. Its specific applications and biological activities would depend on its interaction with biological targets, which could be influenced by the stereochemistry and functional groups present in the molecule. Overall, this compound represents a class of fluorinated organic compounds that are of interest in various fields, including pharmaceuticals and agrochemicals.
Formula:C21H20F3NO6
InChI:InChI=1/C21H20F3NO6/c1-29-16-8-10-4-6-13(25-20(28)21(22,23)24)12-9-15(27)14(26)7-5-11(12)17(10)19(31-3)18(16)30-2/h5,7-9,13H,4,6H2,1-3H3,(H,25,28)(H,26,27)/t13-/m0/s1
SMILES:COc1cc2CC[C@@H](c3cc(=O)c(ccc3c2c(c1OC)OC)O)N=C(C(F)(F)F)O
Synonyms:- Acetamide, 2,2,2-trifluoro-N-(5,6,7,9-tetrahydro-10-hydroxy-1,2,3-trimethoxy-9-oxobenzo(a)heptalen-7-yl)-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.