CymitQuimica logo

CAS 71295-35-7

:

2,2,2-trifluoro-N-methyl-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]acetamide

Description:
2,2,2-Trifluoro-N-methyl-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl]acetamide, with CAS number 71295-35-7, is a complex organic compound characterized by its unique molecular structure, which includes a trifluoromethyl group and a tetramethoxy-substituted benzo[a]heptalene moiety. This compound exhibits significant lipophilicity due to the presence of multiple methoxy groups, which can enhance its solubility in organic solvents. The trifluoromethyl group contributes to its chemical stability and can influence its biological activity, making it of interest in medicinal chemistry. The presence of the acetamide functional group suggests potential interactions with biological targets, possibly affecting its pharmacological properties. Additionally, the stereochemistry indicated by the (7S) configuration may play a crucial role in its biological activity and interactions. Overall, this compound's unique features make it a subject of interest for further research in fields such as drug development and synthetic chemistry.
Formula:C23H24F3NO6
InChI:InChI=1/C23H24F3NO6/c1-27(22(29)23(24,25)26)15-8-6-12-10-18(31-3)20(32-4)21(33-5)19(12)13-7-9-17(30-2)16(28)11-14(13)15/h7,9-11,15H,6,8H2,1-5H3/t15-/m0/s1
SMILES:CN([C@H]1CCc2cc(c(c(c2c2ccc(c(=O)cc12)OC)OC)OC)OC)C(=O)C(F)(F)F
Synonyms:
  • acetamide, 2,2,2-trifluoro-N-methyl-N-[(7S)-5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.