CAS 713-05-3
:N-Methyl-γ-oxo-3-pyridinebutanamide
Description:
N-Methyl-γ-oxo-3-pyridinebutanamide, identified by its CAS number 713-05-3, is a chemical compound that features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound is characterized by the presence of a carbonyl group (C=O) adjacent to the nitrogen atom in the amide functional group, contributing to its reactivity and potential biological activity. The N-methyl substitution indicates that a methyl group is attached to the nitrogen atom, which can influence the compound's solubility and interaction with biological systems. Typically, compounds of this nature may exhibit properties such as moderate polarity, making them soluble in polar solvents while retaining some hydrophobic characteristics due to the aromatic ring. The presence of the pyridine moiety often suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Overall, the specific characteristics, including melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c1-11-10(14)5-4-9(13)8-3-2-6-12-7-8/h2-3,6-7H,4-5H2,1H3,(H,11,14)
InChI key:InChIKey=WOOSCPWOYYLIHS-UHFFFAOYSA-N
SMILES:C(CCC(NC)=O)(=O)C=1C=CC=NC1
Synonyms:- 3-Pyridinebutanamide, N-methyl-γ-oxo-
- 3-Pyridinebutyramide, N-methyl-γ-oxo-
- 3-pyridinebutanamide, N-methyl-gamma-oxo-
- Ba 2702
- N-Methyl-4-oxo-4-(3-pyridinyl)butanamid
- N-Methyl-4-oxo-4-(3-pyridinyl)butanamide
- N-Methyl-γ-oxo-3-pyridinebutanamide
- N-methyl-gamma-oxo-3-Pyridinebutanamide
- γ-(3-Pyridyl)-γ-oxo-N-methylbutyramide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-Methyl-γ-oxo-3-pyridinebutanamide
CAS:Controlled ProductApplications An metabolite of Cotinine. In equilibrium with 5’-Hydroxycotinine the cyclized form.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Morselli, P.L, et al.: J. Med. Chem., 10, 1033 (1967); Murphy, S.E. et. al.: Chem. Res. Toxicol. 12, 639 (1999)Formula:C10H12N2O2Color and Shape:NeatMolecular weight:192.21

