CymitQuimica logo

CAS 713-45-1

:

1-[4-(trifluoromethyl)phenyl]propan-2-one

Description:
1-[4-(Trifluoromethyl)phenyl]propan-2-one, also known as trifluoromethyl phenyl ketone, is an organic compound characterized by its ketone functional group and a trifluoromethyl substituent on a phenyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a relatively low boiling point and moderate solubility in organic solvents, making it useful in various chemical reactions and applications. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound exhibits unique electronic properties due to the electronegative fluorine atoms, which can affect its behavior in chemical reactions. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested. Overall, 1-[4-(trifluoromethyl)phenyl]propan-2-one is an important compound in organic synthesis and materials science.
Formula:C10H9F3O
InChI:InChI=1/C10H9F3O/c1-7(14)6-8-2-4-9(5-3-8)10(11,12)13/h2-5H,6H2,1H3
InChI key:UIPDPUXNQIWJLF-UHFFFAOYSA-N
SMILES:CC(=O)Cc1ccc(cc1)C(F)(F)F
Synonyms:
  • 1-(4-(trifluoromethyl)phenyl)propan-2-one
Found 4 products.