CAS 713-85-9
:3-(3-Fluoro-4-methoxyphenyl)-2-propenoic acid
Description:
3-(3-Fluoro-4-methoxyphenyl)-2-propenoic acid, with the CAS number 713-85-9, is an organic compound characterized by its unique structural features. It contains a propenoic acid moiety, which is a conjugated system that contributes to its reactivity and potential applications in organic synthesis. The presence of a fluorine atom and a methoxy group on the aromatic ring enhances its chemical properties, such as lipophilicity and electronic characteristics, making it a valuable compound in medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its functional groups suggest potential for participating in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H9FO3
InChI:InChI=1S/C10H9FO3/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6H,1H3,(H,12,13)
InChI key:InChIKey=VKZYEBQHWQTZKA-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC(F)=C(OC)C=C1
Synonyms:- (2E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoate
- (2E)-3-(3-fluoro-4-methoxyphenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(3-fluoro-4-methoxyphenyl)-
- 3-(3-Fluoro-4-Methoxyphenyl)Prop-2-Enoic Acid
- 3-(3-Fluoro-4-methoxyphenyl)-2-propenoic acid
- 3-(3-Fluoro-4-methoxyphenyl)acrylic acid
- Cinnamic acid, 3-fluoro-4-methoxy-
- 3'-Fluoro-4'-methoxycinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Fluoro-4-methoxycinnamic acid
CAS:3-Fluoro-4-methoxycinnamic acidFormula:C10H9FO3Purity:97%Color and Shape:Colourless SolidMolecular weight:196.18g/mol3-Fluoro-4-methoxycinnamic acid
CAS:3-Fluoro-4-methoxycinnamic acid is a template for the synthesis of azido compounds. Azide is a versatile functional group that can be used in many chemical reactions. 3-Fluoro-4-methoxycinnamic acid can be used to synthesize various azido products by reacting with hydrogen gas and an appropriate nucleophile, such as acrylic acid or ammonia. This reaction is called the "hydrogenating" reaction because it involves the addition of hydrogen. The target product can be synthesized by adding an appropriate electrophile, such as sodium azide, to the starting material in a solvent such as methylene chloride.Formula:C10H9FO3Purity:Min. 95%Color and Shape:PowderMolecular weight:196.18 g/mol

