CAS 71305-89-0

6(1H)-Azulenone, 2,3-dihydro-1,4-dimethyl-, (R)-

Description:

6(1H)-Azulenone, 2,3-dihydro-1,4-dimethyl-, (R)-, is a chemical compound characterized by its unique bicyclic structure, which includes an azulene moiety. Azulenes are known for their distinct blue color and aromatic properties, and this compound features a ketone functional group at the 6-position of the azulene ring. The presence of two methyl groups at the 1 and 4 positions contributes to its hydrophobic characteristics and influences its reactivity and interaction with other molecules. The (R)- designation indicates that the compound has a specific stereochemistry, which can affect its biological activity and interactions in chiral environments. This compound may exhibit interesting properties such as fluorescence or photochemical behavior due to its conjugated system. Additionally, its potential applications could span various fields, including organic synthesis, materials science, and medicinal chemistry, where the unique structural features may be leveraged for specific functions or activities.

Formula: C₁₂H₁₄O

InChI: InChI=1S/C12H14O/c1-8-3-5-12-9(2)7-10(13)4-6-11(8)12/h4,6-8H,3,5H2,1-2H3/t8-/m1/s1

InChI key: InChIKey=MDFATIDEXXOYPV-MRVPVSSYSA-N

SMILES: CC=1C2=C([C@H](C)CC2)C=CC(=O)C1

Synonyms:

• (R)-1,4-Dimethyl-2,3-dihydroazulen-6(1H)-one
• (1R)-1,4-Dimethyl-1,2,3,6-tetrahydroazulen-6-one
• 6(1H)-Azulenone, 2,3-dihydro-1,4-dimethyl-, (R)-

6(1H)-Azulenone, 2,3-dihydro-1,4-dimethyl

CAS: 71305-89-0

6(1H)-Azulenone, 2,3-dihydro-1,4-dimethyl is an organic compound, which is derived from the structural class of azulenes, known for their nonbenzenoid aromatic properties. This compound is synthesized through specific organic reactions involving the manipulation of its core carbon framework, allowing for the introduction of functional groups critical for its stability and reactivity.

Formula: C₁₂H₁₄O

Purity: Min. 95%

Molecular weight: 174.24 g/mol

Ref: 3D-WCA30589