CAS 71306-36-0

N-(2,6-dichlorophenyl)-N-(prop-2-en-1-yl)-4,5-dihydro-1H-imidazol-2-amine hydrobromide (1:1)

Description:

N-(2,6-dichlorophenyl)-N-(prop-2-en-1-yl)-4,5-dihydro-1H-imidazol-2-amine hydrobromide is a chemical compound characterized by its imidazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a dichlorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the prop-2-en-1-yl substituent indicates that it has an alkene functional group, which may participate in various chemical reactions, including polymerization or addition reactions. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, which may pose environmental and health risks.

Formula: C₁₂H₁₄BrCl₂N₃

InChI: InChI=1/C12H13Cl2N3.BrH/c1-2-8-17(12-15-6-7-16-12)11-9(13)4-3-5-10(11)14;/h2-5H,1,6-8H2,(H,15,16);1H

Alinidine hydrobromide

CAS: 71306-36-0

Alinidine hydrobromide, a specific bradycardic agent, diminishes the slope of the diastolic depolarization in sinoatrial tissue and Purkinje fibers [1].

Formula: C₁₂H₁₄BrCl₂N₃

Color and Shape: Solid

Molecular weight: 351.07

Ref: TM-T61215