CAS 71308-35-5

(4-hydroxy-3,5-dimethylbenzylidene)propanedinitrile

Description:

(4-hydroxy-3,5-dimethylbenzylidene)propanedinitrile, with the CAS number 71308-35-5, is an organic compound characterized by its complex structure that includes a benzylidene moiety and two nitrile groups. This compound features a hydroxyl group and two methyl groups on the aromatic ring, which contribute to its chemical reactivity and potential applications in various fields, including materials science and organic synthesis. The presence of the nitrile functional groups indicates that it may exhibit significant polarity and can participate in nucleophilic addition reactions. Additionally, the hydroxyl group can engage in hydrogen bonding, influencing its solubility and interaction with other molecules. The compound's unique structural features may also impart specific optical properties, making it of interest in the development of dyes or pigments. Overall, (4-hydroxy-3,5-dimethylbenzylidene)propanedinitrile is a versatile compound with potential applications in organic chemistry and materials development, though its specific uses would depend on further research and characterization.

Formula: C₁₂H₁₀N₂O

InChI: InChI=1/C12H10N2O/c1-8-3-10(4-9(2)12(8)15)5-11(6-13)7-14/h3-5,15H,1-2H3

Synonyms:

• ((4-Hydroxy-3,5-dimethylphenyl)methylene)propanedinitrile
• Propanedinitrile, ((4-hydroxy-3,5-dimethylphenyl)methylene)-

Tyrphostin AG17

CAS: 71308-35-5

Tyrphostin AG17 induces fat cell death, regulates fat tissue growth, may treat obesity, and inhibits cancer cell expansion.

Formula: C₁₂H₁₀N₂O

Color and Shape: Solid

Molecular weight: 198.22

Ref: TM-T68822