CAS 71310-21-9
:11-Mercaptoundecanoic acid
Description:
11-Mercaptoundecanoic acid is a thiol compound characterized by the presence of a long hydrocarbon chain and a carboxylic acid functional group. It features an 11-carbon alkyl chain with a thiol (-SH) group at one end and a carboxylic acid (-COOH) group at the other, making it a bifunctional molecule. This structure imparts unique properties, such as the ability to form self-assembled monolayers on metal surfaces, which is valuable in nanotechnology and materials science. The compound is typically a colorless to pale yellow liquid or solid, depending on its state and purity. It is soluble in organic solvents and exhibits moderate solubility in water due to the hydrophilic carboxylic acid group. 11-Mercaptoundecanoic acid is often used in the synthesis of nanoparticles, as a stabilizing agent, and in the development of biosensors. Its reactivity is influenced by the thiol group, which can participate in various chemical reactions, including oxidation and conjugation with other molecules.
Formula:C11H22O2S
InChI:InChI=1S/C11H22O2S/c12-11(13)9-7-5-3-1-2-4-6-8-10-14/h14H,1-10H2,(H,12,13)
InChI key:InChIKey=GWOLZNVIRIHJHB-UHFFFAOYSA-N
SMILES:C(CCCCCCCS)CCC(O)=O
Synonyms:- 11-Mercaptoundecylic acid
- 11-Sulfanylundecanoic Acid
- 11-Thioundecanoic acid
- Undecanoic acid, 11-mercapto-
- ω-Mercaptoundecanoic acid
- 11-Mercaptoundecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
11-Mercaptoundecanoic acid
CAS:Formula:C11H22O2SPurity:95%Color and Shape:SolidMolecular weight:218.3562Ref: IN-DA003DV0
1g31.00€5g82.00€10g109.00€1kgTo inquire25g171.00€100g518.00€250gTo inquire500gTo inquire250mg24.00€11-Mercaptoundecanoic Acid
CAS:Formula:C11H22O2SPurity:>95.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:218.3611-Mercaptoundecanoic Acid
CAS:Controlled Product<p>Applications 11-MERCAPTOUNDECANOIC ACID (cas# 71310-21-9) is a useful research chemical.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C11H22O2SColor and Shape:NeatMolecular weight:218.3611-Mercaptoundecanoic acid
CAS:<p>11-Mercaptoundecanoic acid (11MUA) is a fluorescence probe that reacts with the amide group of proteins. It has been used to study HIV-1 infection and the early stages of human immunodeficiency virus (HIV) replication. 11MUA can be detected by fluorescence spectrometry and gives a strong, selective signal in human serum. This compound is also used as a model system for studying protease activity and electrochemical impedance spectroscopy. 11MUA is stable in solution and can be detected at very low levels, making it an excellent probe for protein degradation studies. The reaction solution containing 11MUA can be prepared using trifluoroacetic acid (TFA), which facilitates the formation of esters from carboxylic acids, or by adding TFA to an acyl chloride derivative of 11-mercaptoundecanoic acid.</p>Formula:C11H22O2SPurity:Min. 95%Color and Shape:White PowderMolecular weight:218.36 g/mol11-Mercaptoundecanoic acid
CAS:Formula:C11H22O2SPurity:95%Color and Shape:SolidMolecular weight:218.36





