CymitQuimica logo

CAS 713141-12-9

:

5-bromo-2-cyanobenzaldehyde

Description:
5-Bromo-2-cyanobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine atom and a cyano group attached to a benzaldehyde moiety. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and polarity. The cyano group (-CN) contributes to the compound's ability to participate in nucleophilic addition reactions, making it a valuable intermediate in organic synthesis. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but less so in water due to its hydrophobic aromatic structure. Its chemical properties are further defined by the aldehyde functional group, which is reactive and can undergo oxidation to form carboxylic acids. 5-Bromo-2-cyanobenzaldehyde is utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential as a building block in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H4BrNO
InChI:InChI=1S/C8H4BrNO/c9-8-2-1-6(4-10)7(3-8)5-11/h1-3,5H
InChI key:TWBKTVRLNPAITK-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Br)C=O)C#N
Found 4 products.