
CAS 713147-52-5
:N-Hydroxy-1-(1-methylethyl)-4-piperidinecarboximidamide
Description:
N-Hydroxy-1-(1-methylethyl)-4-piperidinecarboximidamide, with the CAS number 713147-52-5, is a chemical compound characterized by its unique structural features, including a piperidine ring and a hydroxylamine functional group. This compound typically exhibits properties associated with both amides and hydroxylamines, which may influence its reactivity and potential applications in various fields, such as medicinal chemistry or organic synthesis. The presence of the isopropyl group (1-methylethyl) contributes to its steric properties, potentially affecting its interaction with biological targets or other chemical species. As a piperidine derivative, it may also exhibit basicity due to the nitrogen atom in the ring. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, N-Hydroxy-1-(1-methylethyl)-4-piperidinecarboximidamide is of interest for its potential utility in research and development, particularly in the synthesis of pharmaceuticals or as a reagent in organic reactions.
Formula:C9H19N3O
InChI:InChI=1S/C9H19N3O/c1-7(2)12-5-3-8(4-6-12)9(10)11-13/h7-8,13H,3-6H2,1-2H3,(H2,10,11)
InChI key:InChIKey=LDDGXQSJVMRSHM-UHFFFAOYSA-N
SMILES:C(NO)(=N)C1CCN(C(C)C)CC1
Synonyms:- 4-Piperidinecarboximidamide, N-hydroxy-1-(1-methylethyl)-
- N-Hydroxy-1-(1-methylethyl)-4-piperidinecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.