CAS 7132-61-8

5,6-Dimethyl-2,4-pyrimidinediamine

Description:

5,6-Dimethyl-2,4-pyrimidinediamine, with the CAS number 7132-61-8, is an organic compound characterized by its pyrimidine ring structure, which features two methyl groups at the 5 and 6 positions and two amino groups at the 2 and 4 positions. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate in the synthesis of more complex molecules. The presence of multiple functional groups allows for diverse reactivity, making it a valuable building block in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and stability, can vary based on environmental conditions and the presence of other chemical species. Safety data should be consulted to understand its handling and potential hazards.

Formula: C₆H₁₀N₄

InChI: InChI=1S/C6H10N4/c1-3-4(2)9-6(8)10-5(3)7/h1-2H3,(H4,7,8,9,10)

InChI key: InChIKey=YKPZOMSDVTWDSE-UHFFFAOYSA-N

SMILES: CC=1C(C)=NC(N)=NC1N

Synonyms:

• 5,6-Dimethyl-2,4-pyrimidinediamine
• 5,6-Dimethyl-2,4-diaminopyrimidine
• 2,4-Diamino-5,6-dimethylpyrimidine
• 2,4-Pyrimidinediamine, 5,6-dimethyl-
• Pyrimidine, 2,4-diamino-5,6-dimethyl-
• 2,4-Pyrimidinediamine, 5,6-dimethyl- (9CI)
• 5,6-dimethylpyrimidine-2,4-diamine