CAS 71322-99-1
:2-Methyl-4-piperidone
Description:
2-Methyl-4-piperidone, also known as 2-Methyl-4-piperidinone, is a cyclic organic compound characterized by a piperidone structure with a methyl group at the second position. It has a molecular formula of C6H11NO and features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in water and organic solvents, making it versatile for various chemical reactions. 2-Methyl-4-piperidone is often used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its properties include moderate volatility and stability under standard conditions, although it should be handled with care due to potential health hazards associated with exposure. Additionally, it can undergo various chemical transformations, such as reduction and acylation, which further enhance its utility in synthetic chemistry.
Formula:C6H11NO
InChI:InChI=1/C6H11NO/c1-5-4-6(8)2-3-7-5/h5,7H,2-4H2,1H3
SMILES:CC1CC(=O)CCN1
Synonyms:- 2-Methylpiperidin-4-on
- 2-Methylpiperidin-4-one
- 4-Piperidinone, 2-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
