CAS 71326-18-6

N'-cyclohexyl-N,N-dimethylpropane-1,3-diamine

Description:

N'-Cyclohexyl-N,N-dimethylpropane-1,3-diamine, with the CAS number 71326-18-6, is an organic compound characterized by its amine functional groups. It features a cyclohexyl group attached to a central propane chain that contains two amine groups at the 1 and 3 positions. This structure imparts unique properties, such as being a potential surfactant or emulsifying agent due to its amphiphilic nature. The presence of both cyclohexyl and dimethyl groups contributes to its hydrophobic and hydrophilic characteristics, respectively. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents and may exhibit moderate solubility in water. N'-Cyclohexyl-N,N-dimethylpropane-1,3-diamine can be used in various applications, including as a curing agent in epoxy resins and as a chemical intermediate in the synthesis of other compounds. Safety data should be consulted for handling and exposure guidelines, as amines can be irritants and may pose health risks.

Formula: C₁₁H₂₄N₂

InChI: InChI=1/C11H24N2/c1-13(2)10-6-9-12-11-7-4-3-5-8-11/h11-12H,3-10H2,1-2H3

Synonyms:

• N'-CYCLOHEXYL-N,N-DIMETHYL-1,3-PROPANEDIAMINE