CAS 71326-30-2

N1,N1-Bis(3-aminopropyl)-N3,N3-dimethyl-1,3-propanediamine

Description:

N1,N1-Bis(3-aminopropyl)-N3,N3-dimethyl-1,3-propanediamine, with CAS number 71326-30-2, is a chemical compound characterized by its structure, which includes two 3-aminopropyl groups and two methyl groups attached to a central propanediamine backbone. This compound is classified as a polyamine, which typically exhibits properties such as high solubility in water due to its multiple amine functional groups. It is often utilized in various applications, including as a curing agent in epoxy resins, in the synthesis of surfactants, and in the formulation of polymers. The presence of amine groups contributes to its reactivity, allowing it to participate in various chemical reactions, including cross-linking and polymerization. Additionally, its structure may impart biological activity, making it of interest in medicinal chemistry and biochemistry. Safety data should be consulted for handling and exposure guidelines, as amines can be irritants and may pose health risks.

Formula: C₁₁H₂₈N₄

InChI: InChI=1S/C11H28N4/c1-14(2)8-5-11-15(9-3-6-12)10-4-7-13/h3-13H2,1-2H3

InChI key: InChIKey=NDYOVCQABQIDNF-UHFFFAOYSA-N

SMILES: N(CCCN(C)C)(CCCN)CCCN

Synonyms:

• 1,3-Propanediamine, N,N-bis(3-aminopropyl)-N′,N′-dimethyl-
• 1,3-Propanediamine, N1,N1-bis(3-aminopropyl)-N3,N3-dimethyl-
• N1,N1-Bis(3-aminopropyl)-N3,N3-dimethyl-1,3-propanediamine
• [3-[Bis(3-aminopropyl)amino]propyl]dimethylamine

{3-[Bis(3-aminopropyl)amino]propyl}dimethylamine

CAS: 71326-30-2

Versatile small molecule scaffold

Formula: C₁₁H₂₈N₄

Purity: Min. 95%

Molecular weight: 216.37 g/mol

Ref: 3D-WCA32630