
CAS 7133-46-2
:1,1′-Thiobis[cyclohexane]
Description:
1,1′-Thiobis[cyclohexane], with the CAS number 7133-46-2, is an organic compound characterized by its unique structure, which features two cyclohexane rings connected by a sulfur atom. This compound is part of the class of thioethers, where sulfur serves as a bridge between two hydrocarbon groups. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the sulfur atom imparts specific chemical properties, such as increased reactivity in certain conditions and potential for forming various derivatives. 1,1′-Thiobis[cyclohexane] is relatively stable under standard conditions but may undergo reactions typical of thioethers, including oxidation and substitution reactions. Its applications can be found in organic synthesis and materials science, particularly in the development of polymers and other advanced materials. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C12H22S
InChI:InChI=1S/C12H22S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-12H,1-10H2
InChI key:InChIKey=FTAORUVBXKFVDA-UHFFFAOYSA-N
SMILES:S(C1CCCCC1)C2CCCCC2
Synonyms:- Dicyclohexyl sulfide
- Cyclohexyl sulfide
- Cyclohexane, 1,1′-thiobis-
- 1,1′-Thiobis[cyclohexane]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.