
CAS 71338-71-1
:Phenylmethyl (2E)-2-butenoate
Description:
Phenylmethyl (2E)-2-butenoate, also known as benzyl 2-butenoate, is an organic compound characterized by its ester functional group, which is derived from the reaction of phenylmethyl alcohol and 2-butenoic acid. It typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor. The compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Its molecular structure features a butenoate moiety, which contributes to its reactivity and potential applications in organic synthesis. Phenylmethyl (2E)-2-butenoate can participate in various chemical reactions, including esterification and transesterification, making it useful in the production of other chemical compounds. Additionally, it may exhibit biological activity, which could be of interest in fields such as pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C11H12O2
InChI:InChI=1S/C11H12O2/c1-2-6-11(12)13-9-10-7-4-3-5-8-10/h2-8H,9H2,1H3/b6-2+
InChI key:InChIKey=NCPTYZLUYHXITE-QHHAFSJGSA-N
SMILES:C(OC(/C=C/C)=O)C1=CC=CC=C1
Synonyms:- 2-Butenoic acid, phenylmethyl ester, (2E)-
- 2-Butenoic acid, phenylmethyl ester, (E)-
- Phenylmethyl (2E)-2-butenoate
- Benzyl (E)-crotonate
- Benzyl (E)-2-butenoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(E)-Benzyl but-2-enoate
CAS:(E)-Benzyl but-2-enoate is an organic compound that belongs to the group of growth factors. It is a precursor for the synthesis of other biologically active molecules and also has anti-inflammatory properties. The hydroxy group on this molecule allows it to act as a good solvent for organic solvents, as well as being used in asymmetric syntheses. This compound can be synthesized from benzaldehyde by radiation. (E)-Benzyl but-2-enoate is found in mouse tumor cells and has been shown to have an inhibitory effect on their growth. This fatty acid can also be converted into a hydroxyl group or carboxylic acid through oxidation by fluorine, which results in its anti-inflammatory properties. (E)-Benzyl but-2-enoate binds to c1-4 alkyl groups and fatty acids in the cell membrane, inhibiting their synthesis and leading to cell death. The hydroxy group also gives this compoundFormula:C11H12O2Purity:Min. 95%Molecular weight:176.21 g/mol
