CAS 7134-04-5
:o-Cresolsulfonic acid
Description:
o-Cresolsulfonic acid, with the CAS number 7134-04-5, is an aromatic sulfonic acid derived from o-cresol. It is characterized by the presence of both a hydroxyl group (-OH) and a sulfonic acid group (-SO3H) attached to a benzene ring, which contributes to its acidic properties. This compound typically appears as a colorless to light yellow liquid or solid, depending on its form and concentration. It is soluble in water and polar organic solvents, making it useful in various applications, including as a reagent in organic synthesis and as a pH indicator. o-Cresolsulfonic acid exhibits strong acidity and can act as a catalyst in certain chemical reactions. Additionally, it is known for its antimicrobial properties, which can be beneficial in industrial and laboratory settings. However, it should be handled with care due to its corrosive nature and potential health hazards upon exposure. Proper safety measures, including the use of personal protective equipment, are essential when working with this substance.
Formula:C7H8O4S
InChI:InChI=1/C7H8O4S/c1-5-6(8)3-2-4-7(5)12(9,10)11/h2-4,8H,1H3,(H,9,10,11)
SMILES:Cc1c(cccc1S(=O)(=O)O)O
Synonyms:- 3-Hydroxy-2-methylbenzenesulfonic acid
- Benzenesulfonic Acid, 3-Hydroxy-2-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Hydroxy-3-methylbenzenesulfonic acid
CAS:Formula:C7H8O4SPurity:65%Color and Shape:LiquidMolecular weight:188.2010o-Cresol-4-sulphonic acid
CAS:o-Cresol-4-sulphonic acid is a fine chemical with the CAS number 7134-04-5. It is a versatile building block that can be used as a reagent in research, as a speciality chemical and as an intermediate in the production of other compounds. o-Cresol-4-sulphonic acid has been used to synthesize pharmaceuticals, agrochemicals, dyes, perfumes and many more products. This compound has also been used as a reaction component in organic synthesis to form new compounds and scaffolds.Formula:C7H8O4SPurity:Min. 95%Color and Shape:PowderMolecular weight:188.2 g/mol

