CAS 7134-09-0
:3,4-Dihydroxybenzenesulfonic acid
Description:
3,4-Dihydroxybenzenesulfonic acid, also known as 3,4-Dihydroxy-phenylsulfonic acid, is an aromatic sulfonic acid characterized by the presence of two hydroxyl (-OH) groups and a sulfonic acid (-SO3H) group attached to a benzene ring. This compound is typically a white to light yellow crystalline solid that is soluble in water due to the polar nature of its functional groups. It exhibits acidic properties, primarily due to the sulfonic acid group, which can donate protons in solution. The presence of hydroxyl groups contributes to its reactivity, allowing it to participate in various chemical reactions, including oxidation and substitution. 3,4-Dihydroxybenzenesulfonic acid is often used in the synthesis of dyes, pharmaceuticals, and as a reagent in analytical chemistry. Its structural features also make it a candidate for studying interactions in biological systems and materials science. Safety precautions should be taken when handling this compound, as with many chemical substances, to avoid potential health hazards.
Formula:C6H6O5S
InChI:InChI=1S/C6H6O5S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3,7-8H,(H,9,10,11)
InChI key:InChIKey=LTPDITOEDOAWRU-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC(O)=C(O)C=C1
Synonyms:- Catechol-4-sulfonic acid
- 3,4-Dihydroxybenzenesulfonic acid
- Pyrocatechol-4-sulfonic acid
- Benzenesulfonic acid, 3,4-dihydroxy-
- 4-Sulfopyrocatechol
- 4-sulfocatechol
- Calcium Dobesilate Hydrate Impurity 3
- Calcium Dobesilate Impurity I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
