CAS 7134-11-4
:Guaiacolsulfonicacidpotassium salt; 97%
Description:
Guaiacolsulfonic acid potassium salt, with the CAS number 7134-11-4, is a chemical compound that serves primarily as a reagent in various biochemical applications. It is a potassium salt of guaiacolsulfonic acid, which is derived from guaiacol, a phenolic compound. This substance is typically characterized by its white to off-white crystalline appearance and is soluble in water, making it suitable for use in aqueous solutions. Guaiacolsulfonic acid potassium salt is often utilized in laboratory settings for its role as a pH indicator and in the detection of certain enzymes, particularly in the context of biochemical assays. Its properties include being non-toxic and relatively stable under standard laboratory conditions. Additionally, it may exhibit antioxidant properties and is sometimes used in the formulation of various pharmaceutical products. As with any chemical, proper handling and safety precautions should be observed to mitigate any potential risks associated with its use.
Formula:C7H8O5S
InChI:InChI=1/C7H8O5S/c1-12-7-4-5(13(9,10)11)2-3-6(7)8/h2-4,8H,1H3,(H,9,10,11)
InChI key:InChIKey=QDRCGSIKAHSALR-UHFFFAOYSA-N
SMILES:COc1cc(ccc1O)S(=O)(=O)O
Synonyms:- 1-Hydroxy-2-methoxy-4-phenylsulfonic acid
- 4-Hydroxy-3-Methoxybenzenesulfonic Acid
- Benzenesulfonic acid, 4-hydroxy-3-methoxy-
- Guaiacolsulfonate
- Guaiacolsulfonic acid potassium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


