CAS 7134-19-2
:Methyl N-[(4-chlorophenyl)sulfonyl]-4-nitrobenzenesulfinimidate
Description:
Methyl N-[(4-chlorophenyl)sulfonyl]-4-nitrobenzenesulfinimidate, with CAS number 7134-19-2, is a chemical compound characterized by its sulfonyl and nitro functional groups, which contribute to its reactivity and potential applications in organic synthesis. This compound typically appears as a solid and is soluble in organic solvents, reflecting its polar nature due to the presence of sulfonyl and nitro groups. The sulfinimidate functional group is known for its role in facilitating nucleophilic reactions, making this compound useful in various synthetic pathways, particularly in the formation of amines and other nitrogen-containing compounds. The presence of the 4-chlorophenyl group enhances its electrophilic character, which can be exploited in further chemical transformations. Additionally, the compound's stability under standard laboratory conditions allows for its handling and storage, although care should be taken due to the potential reactivity of its functional groups. Overall, this compound serves as a valuable intermediate in the field of medicinal chemistry and organic synthesis.
Formula:C13H11ClN2O5S2
InChI:InChI=1S/C13H11ClN2O5S2/c1-21-22(12-6-4-11(5-7-12)16(17)18)15-23(19,20)13-8-2-10(14)3-9-13/h2-9H,1H3
InChI key:InChIKey=GIFNUYPIOIDEGE-UHFFFAOYSA-N
SMILES:S(=NS(=O)(=O)C1=CC=C(Cl)C=C1)(OC)C2=CC=C(N(=O)=O)C=C2
Synonyms:- Benzenesulfinimidic acid, N-[(4-chlorophenyl)sulfonyl]-4-nitro-, methyl ester
- Methyl N-[(4-chlorophenyl)sulfonyl]-4-nitrobenzenesulfinimidate
- Benzenesulfinimidic acid, N-[(p-chlorophenyl)sulfonyl]-p-nitro-, methyl ester
- CCG 4986
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
