CAS 71342-67-1

1-Ethyl-2,4,5-imidazolidinetrione 5-(O-methyloxime)

Description:

1-Ethyl-2,4,5-imidazolidinetrione 5-(O-methyloxime), with the CAS number 71342-67-1, is a chemical compound that belongs to the class of imidazolidinetriones, which are characterized by a five-membered ring structure containing nitrogen and carbon atoms. This compound features an ethyl group and a methyloxime functional group, which contribute to its unique chemical properties. Typically, imidazolidinetriones exhibit stability under standard conditions and can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The presence of the oxime group suggests potential reactivity towards electrophiles, making it useful in organic synthesis. Additionally, compounds of this type may have applications in pharmaceuticals or agrochemicals due to their biological activity. However, specific information regarding its solubility, melting point, and other physical properties would require further investigation or experimental data. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.

Formula: C₆H₉N₃O₃

InChI: InChI=1S/C6H9N3O3/c1-3-9-4(8-12-2)5(10)7-6(9)11/h3H2,1-2H3,(H,7,10,11)

InChI key: InChIKey=IWOKFBNWXNLMMA-UHFFFAOYSA-N

SMILES: N(OC)=C1N(CC)C(=O)NC1=O

Synonyms:

• (5Z)-1-ethyl-5-(methoxyimino)imidazolidine-2,4-dione
• 1-Ethyl-2,4,5-imidazolidinetrione 5-(O-methyloxime)
• 2,4,5-Imidazolidinetrione, 1-ethyl-, 5-(O-methyloxime)
• 2,4,5-imidazolidinetrione, 1-ethyl-, 5-(O-methyloxime), (5Z)-
• Imidazolidinetrione, ethyl-, 5-(O-methyloxime)