CAS 71348-43-1

3,3-Diethyl 1,5-dioxaspiro[5.5]undecane-3,3-dicarboxylate

Description:

3,3-Diethyl 1,5-dioxaspiro[5.5]undecane-3,3-dicarboxylate is a chemical compound characterized by its unique spirocyclic structure, which consists of a dioxaspiro framework. This compound features two ethyl groups attached to the central carbon, contributing to its diethyl designation. The presence of two carboxylate groups indicates that it can participate in various chemical reactions, including esterification and potential interactions with nucleophiles. The dioxaspiro structure imparts rigidity and may influence the compound's physical properties, such as solubility and melting point. Typically, compounds of this nature are of interest in organic synthesis and materials science due to their potential applications in drug development, polymer chemistry, and as intermediates in various chemical reactions. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the ethyl groups and the dioxaspiro framework. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₅H₂₄O₆

InChI: InChI=1S/C15H24O6/c1-3-18-12(16)14(13(17)19-4-2)10-20-15(21-11-14)8-6-5-7-9-15/h3-11H2,1-2H3

InChI key: InChIKey=XNASOZGGRNSFGK-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1(C(OCC)=O)COC2(OC1)CCCCC2

Synonyms:

• 3,3-Diethyl 1,5-dioxaspiro[5.5]undecane-3,3-dicarboxylate
• 1,5-Dioxaspiro[5.5]undecane-3,3-dicarboxylic acid, 3,3-diethyl ester
• 1,5-Dioxaspiro[5.5]undecane-3,3-dicarboxylic acid, diethyl ester