CAS 7135-02-6

5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine

Description:

5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features two methyl groups at the 5 and 7 positions of the triazole ring, contributing to its chemical stability and potential biological activity. The presence of an amino group at the 2-position of the pyrimidine ring enhances its reactivity and solubility in polar solvents. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anti-cancer activities. Its molecular structure allows for various interactions with biological targets, making it a candidate for drug development. Additionally, the compound's CAS number, 7135-02-6, facilitates its identification in chemical databases and literature. Overall, 5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine exemplifies the diverse chemistry of nitrogen-containing heterocycles and their applications in pharmaceuticals.

Formula: C₇H₉N₅

InChI: InChI=1/C7H9N5/c1-4-3-5(2)12-7(9-4)10-6(8)11-12/h3H,1-2H3,(H2,8,11)

SMILES: Cc1cc(C)n2c(n1)nc(=N)[nH]2

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyrimidin-2-amine, 5,7-dimethyl-
• 5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine

5,7-Dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-ylamine

CAS: 7135-02-6

Formula: C₇H₉N₅

Purity: 98%

Molecular weight: 163.1799

Ref: IN-DA00FD8G

2-Amino-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine

CAS: 7135-02-6

2-Amino-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 163.18g/mol

Ref: 54-OR15182

5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine

CAS: 7135-02-6

Formula: C₇H₉N₅

Purity: 98%

Molecular weight: 163.184

Ref: 10-F307318