
CAS 713512-19-7
:1-Hexyl-3-methylimidazolium tris(pentafluoroethyl)trifluorophosphate
Description:
1-Hexyl-3-methylimidazolium tris(pentafluoroethyl)trifluorophosphate, with CAS number 713512-19-7, is an ionic liquid that belongs to the class of imidazolium-based salts. This compound features a long hydrophobic hexyl chain and a methyl group on the imidazolium ring, contributing to its unique properties. The presence of the tris(pentafluoroethyl)trifluorophosphate anion imparts significant thermal stability and low volatility, making it suitable for various applications, including as a solvent in chemical reactions and as an electrolyte in electrochemical devices. Its ionic nature allows for high ionic conductivity, while the fluorinated anion enhances its solvation properties and chemical stability. Additionally, this ionic liquid exhibits low toxicity and is considered environmentally friendly compared to traditional organic solvents. The combination of these characteristics makes it a valuable substance in fields such as green chemistry, materials science, and energy storage technologies.
Formula:C10H19N2·C6F18P
InChI:InChI=1S/C10H19N2.C6F18P/c1-3-4-5-6-7-12-9-8-11(2)10-12;7-1(8,9)4(16,17)25(22,23,24,5(18,19)2(10,11)12)6(20,21)3(13,14)15/h8-10H,3-7H2,1-2H3;/q+1;-1
InChI key:InChIKey=RDTBYJUWNPIEFT-UHFFFAOYSA-N
SMILES:[P+5]([C-](C(F)(F)F)(F)F)([C-](C(F)(F)F)(F)F)([C-](C(F)(F)F)(F)F)([F-])([F-])[F-].C(CCCCC)[N+]1=CN(C)C=C1
Synonyms:- 1H-Imidazolium, 1-hexyl-3-methyl-, trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
- 1-Hexyl-3-methylimidazolium trifluorotris(pentafluoroethyl)phosphate
- 1-Methyl-3-hexylimidazolium tris(pentafluoroethyl)trifluorophosphate
- 1-Hexyl-3-methylimidazolium tris(pentafluoroethyl)trifluorophosphate
- 1H-Imidazolium, 1-hexyl-3-methyl-, trifluorotris(pentafluoroethyl)phosphate(1-)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.