CAS 7136-41-6

5-(piperidin-1-ylmethyl)thiophene-2-carbaldehyde

Description:

5-(Piperidin-1-ylmethyl)thiophene-2-carbaldehyde is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a piperidine group, a six-membered nitrogen-containing ring, contributes to its potential biological activity and reactivity. This compound features an aldehyde functional group, which is known for its reactivity in various chemical reactions, including nucleophilic addition and condensation reactions. The thiophene moiety provides unique electronic properties, making it useful in organic electronics and as a building block in the synthesis of pharmaceuticals and agrochemicals. The compound's structure suggests it may exhibit interesting interactions with biological targets, potentially leading to applications in medicinal chemistry. Additionally, its solubility and stability in various solvents can influence its utility in synthetic processes. Overall, 5-(piperidin-1-ylmethyl)thiophene-2-carbaldehyde is a versatile compound with significant implications in both research and industrial applications.

Formula: C₁₁H₁₅NOS

InChI: InChI=1/C11H15NOS/c13-9-11-5-4-10(14-11)8-12-6-2-1-3-7-12/h4-5,9H,1-3,6-8H2

SMILES: C1CCN(CC1)Cc1ccc(C=O)s1

Synonyms:

• 2-Thiophenecarboxaldehyde, 5-(1-Piperidinylmethyl)-
• 5-(Piperidin-1-ylmethyl)thiophene-2-carbaldehyde