CAS 7137-54-4
:1-nitro-2-propylbenzene
Description:
1-Nitro-2-propylbenzene, with the CAS number 7137-54-4, is an organic compound belonging to the class of nitroalkylbenzenes. It features a nitro group (-NO2) attached to a propyl group that is further connected to a benzene ring. This compound is typically a colorless to pale yellow liquid with a characteristic aromatic odor. It is relatively insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. The presence of the nitro group imparts certain reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitutions or reductions. 1-Nitro-2-propylbenzene can be used in various applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. Safety considerations are important, as nitro compounds can be hazardous, requiring proper handling and storage to mitigate risks associated with toxicity and environmental impact.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-2-5-8-6-3-4-7-9(8)10(11)12/h3-4,6-7H,2,5H2,1H3
SMILES:CCCc1ccccc1N(=O)=O
Synonyms:- 1-Nitro-2-propylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
