CAS 71372-41-3

(3-chlorophenyl)(3-methylphenyl)methanone

Description:

(3-chlorophenyl)(3-methylphenyl)methanone, also known by its CAS number 71372-41-3, is an organic compound characterized by the presence of a ketone functional group attached to two aromatic rings. The structure features a chlorinated phenyl group and a methyl-substituted phenyl group, which contribute to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic nature. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological systems, making it a subject of study in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₄H₁₁ClO

InChI: InChI=1/C14H11ClO/c1-10-4-2-5-11(8-10)14(16)12-6-3-7-13(15)9-12/h2-9H,1H3

SMILES: Cc1cccc(c1)C(=O)c1cccc(c1)Cl

Synonyms:

• Methanone, (3-chlorophenyl)(3-methylphenyl)-
• (3-Chlorophenyl)(3-methylphenyl)methanone