CAS 7138-40-1: Heptacosanoic acid
Description:Heptacosanoic acid, also known as C27 fatty acid, is a long-chain saturated fatty acid with the molecular formula C27H54O2. It is characterized by a straight-chain structure consisting of 27 carbon atoms and a carboxylic acid functional group (-COOH) at one end. This compound is typically found in various natural sources, including certain plant oils and animal fats. Heptacosanoic acid is a waxy solid at room temperature, exhibiting low solubility in water due to its hydrophobic nature, but it is soluble in organic solvents like ethanol and chloroform. Its melting point is relatively high compared to shorter-chain fatty acids, reflecting its long carbon chain. Heptacosanoic acid is of interest in various fields, including biochemistry and materials science, due to its potential applications in the production of biodiesel, surfactants, and as a precursor for synthesizing other chemical compounds. Additionally, it may have implications in nutrition and health, although further research is needed to fully understand its biological effects.
Formula:C27H54O2
InChI:InChI=1S/C27H54O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(28)29/h2-26H2,1H3,(H,28,29)
InChI key:InChIKey=VXZBFBRLRNDJCS-UHFFFAOYSA-N
SMILES:O=C(O)CCCCCCCCCCCCCCCCCCCCCCCCCC
- Synonyms:
- Heptacosanoic acid
- Carboceric acid
- Heptacosylic acid