
CAS 71384-23-1
:Quinoline, 1-acetyl-5-[[(2S,4aR,5S,6aR,7S,9R,10aS)-2,3,4,4a,6,6a,7,8,9,10,10a,11-dodecahydro-9,12-dimethyl-7,5-(iminomethano)-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-2-yl]methyl]decahydro-7-methyl-, (4aS,5R,7S,8aR)-
Description:
Quinoline, 1-acetyl-5-[[(2S,4aR,5S,6aR,7S,9R,10aS)-2,3,4,4a,6,6a,7,8,9,10,10a,11-dodecahydro-9,12-dimethyl-7,5-(iminomethano)-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-2-yl]methyl]decahydro-7-methyl-, (4aS,5R,7S,8aR)- is a complex organic compound characterized by its intricate molecular structure, which includes multiple fused ring systems and various stereocenters. This compound features a quinoline moiety, which is known for its aromatic properties and potential biological activity. The presence of an acetyl group suggests that it may participate in various chemical reactions, including acylation and condensation. The stereochemistry indicated by the specific configuration at several chiral centers implies that the compound may exhibit unique pharmacological properties, potentially influencing its interaction with biological targets. Additionally, the presence of multiple functional groups may enhance its solubility and reactivity, making it of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules in the realm of chemical research.
Formula:C30H49N3O
InChI:InChI=1S/C30H49N3O/c1-18-11-22-16-28-25(23-15-27(22)29(12-18)32(4)17-23)8-7-24(31-28)14-21-10-19(2)13-30-26(21)6-5-9-33(30)20(3)34/h18-19,21-27,29-30H,5-17H2,1-4H3/t18-,19+,21-,22+,23-,24+,25-,26+,27-,29+,30-/m1/s1
InChI key:InChIKey=ZGALAVFQYJOLRQ-XLMCSZFMSA-N
SMILES:CN1[C@@]2([C@]3([C@](CC=4[C@@]([C@](C3)(C1)[H])(CC[C@@H](C[C@@H]5[C@]6([C@](N(C(C)=O)CCC6)(C[C@@H](C)C5)[H])[H])N4)[H])(C[C@@H](C)C2)[H])[H])[H]
Synonyms:- 7,5-(Iminomethano)-5H-benzo[5,6]cyclohepta[1,2-b]pyridine, quinoline deriv.
- Serratanine
- Quinoline, 1-acetyl-5-[[(2S,4aR,5S,6aR,7S,9R,10aS)-2,3,4,4a,6,6a,7,8,9,10,10a,11-dodecahydro-9,12-dimethyl-7,5-(iminomethano)-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-2-yl]methyl]decahydro-7-methyl-, (4aS,5R,7S,8aR)-
- Serratanine A
- Lucidine B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Serratanine
CAS:Serratanine is a mixture of serratanine A & serratanine B; serratanine A same as lucidine B; serratanine B same as oxolucidine B.Formula:C30H49N3OColor and Shape:SolidMolecular weight:467.742
