CAS 7139-63-1

1,3,4,6-tetra-O-acetyl-2-deoxy-2-[(trifluoroacetyl)amino]hexopyranose

Description:

1,3,4,6-Tetra-O-acetyl-2-deoxy-2-[(trifluoroacetyl)amino]hexopyranose is a synthetic carbohydrate derivative characterized by its complex structure, which includes multiple acetyl groups and a trifluoroacetylamino moiety. This compound is a modified hexopyranose, specifically a deoxy sugar, indicating the absence of a hydroxyl group at the second carbon position. The presence of four acetyl groups suggests that it has enhanced lipophilicity and stability, making it useful in various chemical applications, including as a protecting group in carbohydrate chemistry. The trifluoroacetyl group contributes to its reactivity and can influence its biological activity, potentially enhancing its interaction with biological targets. This compound is typically utilized in research settings, particularly in the synthesis of glycosides and other carbohydrate derivatives. Its unique functional groups allow for selective reactions, making it a valuable intermediate in organic synthesis and medicinal chemistry. As with many synthetic compounds, handling should be done with care, considering potential hazards associated with its chemical structure.

Formula: C₁₆H₂₀F₃NO₁₀

InChI: InChI=1/C16H20F3NO10/c1-6(21)26-5-10-12(27-7(2)22)13(28-8(3)23)11(14(30-10)29-9(4)24)20-15(25)16(17,18)19/h10-14H,5H2,1-4H3,(H,20,25)

SMILES: CC(=O)OCC1C(C(C(C(OC(=O)C)O1)N=C(C(F)(F)F)O)OC(=O)C)OC(=O)C

1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trifluoracetamido-D-glucose

CAS: 7139-63-1

Molecular weight: 443.33

Ref: 7W-GC1939

1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trifluoroacetamido-D-glucopyranose

CAS: 7139-63-1

1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trifluoroacetamido-D-glucopyranose is a carbohydrate that has been modified with fluorine and acetyl groups. It is used as a precursor to other saccharides. The compound is synthesized by the reaction of 1,3,4,6-tetra -O-acetyl glucose with trifluoroacetic anhydride in methylene chloride. It can be custom synthesized for research purposes. This product has high purity and is sold in both liquid and powder form.

Formula: C₁₆H₂₀F₃NO₁₀

Purity: Min. 95%

Molecular weight: 443.33 g/mol

Ref: 3D-MT07375