CAS 7139-64-2
:p-Coumaroylglucose
Description:
p-Coumaroylglucose is a phenolic compound that belongs to the class of flavonoids and is characterized by the presence of a coumaroyl group attached to a glucose molecule. This compound typically exhibits a yellow to brown color and is soluble in polar solvents, such as water and alcohol, due to the hydroxyl groups present in its structure. p-Coumaroylglucose is known for its antioxidant properties, which can help in scavenging free radicals and may contribute to various health benefits. It is often found in plants and is associated with plant defense mechanisms against pathogens and herbivores. Additionally, this compound may play a role in the biosynthesis of lignin and other secondary metabolites, contributing to the structural integrity and resilience of plant tissues. Its potential applications in food, pharmaceuticals, and cosmetics are being explored, particularly due to its bioactive properties. Overall, p-Coumaroylglucose is a significant compound in both plant biology and potential therapeutic contexts.
Formula:C15H18O8
InChI:InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(22-10)23-11(18)6-3-8-1-4-9(17)5-2-8/h1-6,10,12-17,19-21H,7H2/t10-,12-,13+,14-,15+/m1/s1
InChI key:InChIKey=DSNCQKUYZOSARM-LFHLZQBKSA-N
SMILES:O(C(C=CC1=CC=C(O)C=C1)=O)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- p-Coumaroylglucose
- β-D-Glucopyranose, 1-[3-(4-hydroxyphenyl)-2-propenoate]
- Glucopyranose, 1-(p-hydroxycinnamate), β-D-
- Glucopyranose, 1-p-hydroxycinnamate
- Cinnamic acid, p-hydroxy-, β-D-glucopyranosyl ester
- beta-D-Glucopyranose 1-[3-(4-hydroxyphenyl)-2-propenoate]
- p-Coumaroyl-b-D-glucose
- 1-O-p-coumaroyl-β-D-glucopyranose
- 1-O-(4-coumaroyl)-beta-D-glucose
- beta-D-Glucose 1-(p-hydroxycinnamate)
- 1-O-p-Coumaroyl-beta-D-glucose
- 1-O-p-Coumaroylglucose
- 1-p-Cumaroylglucose
- p-Coumarylglucose
- beta-D-Glucopyranose 1-(p-hydroxycinnamate)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
p-Coumaroyl-b-D-glucose
CAS:Formula:C15H18O8Purity:98.0%Color and Shape:SolidMolecular weight:326.29861-O-p-Coumaroyl-β-D-glucose
CAS:1-O-p-Coumaroyl-β-D-glucose, a compound extractable from Luffa cylindrica (L.) Roem (sponge gourds) [1] [2], has been found to enhance glucose uptake in HuH7 cells.Formula:C15H18O8Color and Shape:SolidMolecular weight:326.3011-O-p-Coumaroyl β-D-glucopyranose
CAS:1-O-p-Coumaroyl β-D-glucopyranoseMolecular weight:326.29862g/mol1-O-p-Coumaroyl β-D-glucopyranose
CAS:Formula:C15H18O8Purity:≥ 98.0%Color and Shape:White to off-white crystalline solidMolecular weight:326.3p-Coumaroyl-b-D-glucose
CAS:Controlled ProductFormula:C15H18O8Color and Shape:NeatMolecular weight:326.299p-Coumaroyl-b-D-glucose
CAS:P-Coumaroyl-b-D-glucose is a flavanone that belongs to the class of flavonoids. It is an intermediate in the synthesis of many other flavonoids, such as apigenin, labiatae, and rhamnetin. P-Coumaroyl-b-D-glucose has been shown to downregulate the expression of genes encoding proteins involved in the biosynthesis of proanthocyanidins and anthocyanins. This compound also induces apoptosis by binding to the mitochondria membrane and increasing reactive oxygen species production. P-Coumaroyl-b-D-glucose can be used as a marker for phenylpropanoid metabolism in plants.
Formula:C15H18O8Purity:Min. 95%Color and Shape:White PowderMolecular weight:326.3 g/mol





