CAS 71392-09-1

N-benzyl-N-methyl-3-oxobutanamide

Description:

N-benzyl-N-methyl-3-oxobutanamide is an organic compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a benzyl group, which contributes to its hydrophobic characteristics, and a methyl group attached to the nitrogen atom, influencing its steric and electronic properties. The presence of the 3-oxobutanamide structure indicates that it contains a ketone functional group adjacent to the amide, which can participate in various chemical reactions, such as nucleophilic additions. The compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular forces. Its solubility in organic solvents and limited solubility in water is typical for amides with larger hydrophobic groups. N-benzyl-N-methyl-3-oxobutanamide may have applications in pharmaceuticals or as an intermediate in organic synthesis, owing to its unique structural features that can influence biological activity and reactivity.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1/C12H15NO2/c1-10(14)8-12(15)13(2)9-11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3

SMILES: CC(=O)CC(=O)N(C)Cc1ccccc1

Synonyms:

• butanamide, N-methyl-3-oxo-N-(phenylmethyl)-