CAS 71394-99-5
:2-Bromo-N-(2,6-diethylphenyl)butanamide
Description:
2-Bromo-N-(2,6-diethylphenyl)butanamide is a chemical compound characterized by its unique structure, which includes a butanamide backbone substituted with a bromine atom and a diethylphenyl group. This compound typically exhibits properties associated with amides, such as moderate polarity due to the presence of the amide functional group, which can engage in hydrogen bonding. The bromine substituent may influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The presence of the diethylphenyl group contributes to its hydrophobic character, which can affect its solubility in different solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in organic synthesis and pharmaceutical development. As with many brominated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts. Overall, 2-Bromo-N-(2,6-diethylphenyl)butanamide represents a complex molecule with diverse chemical properties and potential applications.
Formula:C14H20BrNO
InChI:InChI=1S/C14H20BrNO/c1-4-10-8-7-9-11(5-2)13(10)16-14(17)12(15)6-3/h7-9,12H,4-6H2,1-3H3,(H,16,17)
InChI key:InChIKey=MAESMPMXHGHIQV-UHFFFAOYSA-N
SMILES:N(C(C(CC)Br)=O)C1=C(CC)C=CC=C1CC
Synonyms:- Butanamide, 2-bromo-N-(2,6-diethylphenyl)-
- 2-Bromo-N-(2,6-diethylphenyl)butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.