CAS 71404-99-4

benzyl [(3S)-1-(benzyloxy)-2-oxoazetidin-3-yl]carbamate

Description:

Benzyl [(3S)-1-(benzyloxy)-2-oxoazetidin-3-yl]carbamate is a chemical compound characterized by its unique structural features, which include a carbamate functional group and an azetidine ring. The presence of the benzyloxy group contributes to its potential as a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals. The stereochemistry indicated by the (3S) configuration suggests that the compound exhibits chirality, which can influence its biological activity and interactions. This compound may exhibit properties typical of carbamates, such as being a potential inhibitor or modulator in various biochemical pathways. Its molecular structure allows for hydrogen bonding and other intermolecular interactions, which can affect its solubility and reactivity. Additionally, the presence of the azetidine ring may impart unique strain and reactivity patterns, making it of interest in medicinal chemistry. Overall, this compound's characteristics make it a subject of interest for further research in synthetic and medicinal chemistry applications.

Formula: C₁₈H₁₈N₂O₄

InChI: InChI=1/C18H18N2O4/c21-17-16(11-20(17)24-13-15-9-5-2-6-10-15)19-18(22)23-12-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H,19,22)/t16-/m0/s1

SMILES: c1ccc(cc1)COC(=N[C@H]1CN(C1=O)OCc1ccccc1)O

Synonyms:

• (S)-[1-(Benzyloxy)-2-oxo-3-azetidinyl]carbamic Acid Benzyl Ester
• [(3S)-2-Oxo-1-(phenylMethoxy)-3-azetidinyl]carbaMic Acid PhenylMethyl Ester
• 71404-99-4
• Carbamic acid, N-[(3S)-2-oxo-1-(phenylmethoxy)-3-azetidinyl]-, phenylmethyl ester

(S)-[1-(Benzyloxy)-2-oxo-3-azetidinyl]carbamic Acid Benzyl Ester

Controlled Product

CAS: 71404-99-4

Formula: C₁₈H₁₈N₂O₄

Color and Shape: Neat

Molecular weight: 326.35

Ref: TR-B287500