CAS 71405-01-1

tert-butyl N-[(3S)-1-hydroxy-2-oxo-azetidin-3-yl]carbamate

Description:

Tert-butyl N-[(3S)-1-hydroxy-2-oxo-azetidin-3-yl]carbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group and a carbamate functional group attached to a chiral azetidine derivative. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological systems. The presence of the hydroxy and carbonyl groups contributes to its reactivity and solubility in various solvents. The stereochemistry of the azetidine ring is significant, as it can influence the compound's biological activity and interactions with enzymes or receptors. Additionally, the tert-butyl group enhances the lipophilicity of the molecule, which can affect its pharmacokinetic properties. Overall, tert-butyl N-[(3S)-1-hydroxy-2-oxo-azetidin-3-yl]carbamate represents a class of compounds that are of interest for their potential therapeutic applications and their role in the study of chiral molecules in drug design.

Formula: C₈H₁₄N₂O₄

InChI: InChI=1/C8H14N2O4/c1-8(2,3)14-7(12)9-5-4-10(13)6(5)11/h5,13H,4H2,1-3H3,(H,9,12)/t5-/m0/s1

SMILES: CC(C)(C)OC(=N[C@H]1CN(C1=O)O)O