CAS 71406-66-1
:4-chloro-6-ethyl-N,N-dimethylpyrimidin-2-amine
Description:
4-Chloro-6-ethyl-N,N-dimethylpyrimidin-2-amine is a chemical compound belonging to the pyrimidine class, characterized by a pyrimidine ring substituted with a chlorine atom, an ethyl group, and two dimethylamino groups. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals due to its structural features. The presence of the chloro and dimethylamino groups can influence its reactivity and solubility in various solvents, making it a candidate for further chemical modifications. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its biological activity and stability. Additionally, the specific arrangement of substituents on the pyrimidine ring can lead to unique pharmacological properties, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C8H12ClN3
InChI:InChI=1/C8H12ClN3/c1-4-6-5-7(9)11-8(10-6)12(2)3/h5H,4H2,1-3H3
SMILES:CCc1cc(Cl)nc(n1)N(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
