CAS 71408-03-2

5-Acetyl-2-amino-4-hydroxybenzonitrile

Description:

5-Acetyl-2-amino-4-hydroxybenzonitrile, with the CAS number 71408-03-2, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an acetyl group, an amino group, a hydroxy group, and a nitrile group. This compound typically exhibits properties associated with both aromatic compounds and functional groups present in its structure. The presence of the hydroxy group suggests potential for hydrogen bonding, which can influence its solubility and reactivity. The amino group may impart basic characteristics, while the nitrile group contributes to its polarity and potential for nucleophilic reactions. In terms of applications, compounds like this may be of interest in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis due to their diverse functional groups. Its specific reactivity and interactions would depend on the conditions and the presence of other reagents. Overall, 5-Acetyl-2-amino-4-hydroxybenzonitrile represents a versatile structure in organic chemistry with potential utility in various chemical applications.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-5(12)7-2-6(4-10)8(11)3-9(7)13/h2-3,13H,11H2,1H3

InChI key: InChIKey=VAXODCHUNJTZSO-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(O)C=C(N)C(C#N)=C1

Synonyms:

• Benzonitrile, 5-acetyl-2-amino-4-hydroxy-
• 5-Acetyl-2-amino-4-hydroxybenzonitrile
• 4′-Amino-5′-cyano-2′-hydroxyacetophenone
• 4-Amino-5-cyano-2-hydroxyacetophenone