CAS 7142-91-8

N-(4-methyl-3,5-dinitrophenyl)acetamide

Description:

N-(4-methyl-3,5-dinitrophenyl)acetamide, with the CAS number 7142-91-8, is an organic compound characterized by its aromatic structure and the presence of both acetamide and dinitrophenyl functional groups. This compound features a dinitrophenyl moiety, which is known for its strong electron-withdrawing properties due to the presence of nitro groups, influencing its reactivity and stability. The methyl group attached to the phenyl ring can affect the compound's solubility and overall chemical behavior. Typically, compounds like this may exhibit moderate to high toxicity and are often used in research settings, particularly in studies related to chemical synthesis or as intermediates in the production of other chemical entities. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions are essential when handling this compound due to its potential hazards associated with the nitro groups.

Formula: C₉H₉N₃O₅

InChI: InChI=1/C9H9N3O5/c1-5-8(11(14)15)3-7(10-6(2)13)4-9(5)12(16)17/h3-4H,1-2H3,(H,10,13)

SMILES: Cc1c(cc(cc1N(=O)=O)N=C(C)O)N(=O)=O