CAS 7142-94-1

2-[(4-chlorophenyl)carbamoyl]benzoic acid

Description:

2-[(4-Chlorophenyl)carbamoyl]benzoic acid, with the CAS number 7142-94-1, is an organic compound characterized by its structural features, which include a benzoic acid moiety and a carbamoyl group attached to a para-chlorophenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. It may display acidic behavior due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. The presence of the chlorophenyl group can influence its reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. Additionally, this compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis often involves the reaction of benzoic acid derivatives with isocyanates or related reagents. Overall, 2-[(4-chlorophenyl)carbamoyl]benzoic acid is a compound of interest in various chemical and pharmaceutical applications.

Formula: C₁₄H₁₀ClNO₃

InChI: InChI=1/C14H10ClNO3/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(18)19/h1-8H,(H,16,17)(H,18,19)

SMILES: c1ccc(c(c1)C(=O)Nc1ccc(cc1)Cl)C(=O)O

Synonyms:

• Benzoic Acid, 2-[[(4-Chlorophenyl)Amino]Carbonyl]-

N-(4-Chloro-phenyl)-phthalamic acid

CAS: 7142-94-1

Formula: C₁₄H₁₀ClNO₃

Purity: 95.0%

Molecular weight: 275.69

Ref: 10-F494540