
CAS 71420-37-6
:2-[[5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]acetic acid
Description:
2-[[5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]acetic acid, identified by its CAS number 71420-37-6, is an organic compound characterized by its unique structure that includes a cyclohexyl group substituted with a methyl and isopropyl group, linked to an acetic acid moiety through an ether bond. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the bulky cyclohexyl group may impart hydrophobic characteristics, affecting its interaction with biological membranes and its overall bioavailability. Additionally, the compound may demonstrate specific reactivity patterns due to the functional groups present, making it of interest in various chemical applications, including potential pharmaceutical uses. Its synthesis and stability would depend on the conditions under which it is handled, as well as the presence of other reactive species in the environment. Overall, this compound's unique structure suggests a range of potential applications in organic synthesis and medicinal chemistry.
Formula:C12H22O3
InChI:InChI=1S/C12H22O3/c1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,4-7H2,1-3H3,(H,13,14)
InChI key:InChIKey=CILPHQCEVYJUDN-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1C(C(C)C)CCC(C)C1
Synonyms:- [[5-Methyl-2-(propan-2-yl)cyclohexyl]oxy]acetic acid
- 2-[[5-Methyl-2-(1-methylethyl)cyclohexyl]oxy]acetic acid
- NSC 43708
- Acetic acid, [[5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-
- Acetic acid, 2-[[5-methyl-2-(1-methylethyl)cyclohexyl]oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.