CAS 714220-73-2

2,7-Dichloro-11-(4-methyl-1-piperazinyl)dibenz[b,f][1,4]oxazepine

Description:

2,7-Dichloro-11-(4-methyl-1-piperazinyl)dibenz[b,f][1,4]oxazepine is a chemical compound characterized by its complex structure, which includes a dibenzoxazepine core with chlorine substituents and a piperazine moiety. This compound typically exhibits properties associated with its heterocyclic structure, such as potential biological activity, particularly in the realm of pharmacology. The presence of chlorine atoms can influence its lipophilicity and reactivity, while the piperazine group may contribute to its interaction with biological targets, possibly enhancing its efficacy as a therapeutic agent. The compound's molecular structure suggests it may be investigated for its potential use in treating various conditions, possibly related to the central nervous system, given the common applications of similar compounds. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to regulatory scrutiny depending on its intended use. Overall, 2,7-Dichloro-11-(4-methyl-1-piperazinyl)dibenz[b,f][1,4]oxazepine represents a class of compounds that could have significant implications in medicinal chemistry.

Formula: C₁₈H₁₇Cl₂N₃O

InChI: InChI=1S/C18H17Cl2N3O/c1-22-6-8-23(9-7-22)18-14-10-12(19)3-5-16(14)24-17-11-13(20)2-4-15(17)21-18/h2-5,10-11H,6-9H2,1H3

InChI key: InChIKey=DOCIUEIFZJXDJU-UHFFFAOYSA-N

SMILES: ClC=1C=C2C(=NC=3C(OC2=CC1)=CC(Cl)=CC3)N4CCN(C)CC4

Synonyms:

• Dibenz[b,f][1,4]oxazepine, 2,7-dichloro-11-(4-methyl-1-piperazinyl)-
• 2,7-Dichloro-11-(4-methyl-1-piperazinyl)dibenz[b,f][1,4]oxazepine

7-Chloro Loxapine

Controlled Product

CAS: 714220-73-2

Formula: C₁₈H₁₇Cl₂N₃O

Color and Shape: Neat

Molecular weight: 362.253

Ref: TR-C368385