CAS 714255-28-4
:4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid
Description:
4,5,6,7-Tetrahydro-1H-indazole-3-carboxylic acid is a bicyclic organic compound characterized by its indazole structure, which consists of a five-membered ring fused to a six-membered ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and pharmaceutical research, often investigated for its potential biological activities, including anti-inflammatory and neuroprotective effects. Its molecular structure allows for various chemical modifications, which can enhance its pharmacological properties. As with many organic compounds, it is essential to handle it with care, adhering to safety protocols, as it may exhibit toxicity or reactivity under certain conditions. Overall, 4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid represents a significant compound in the exploration of new therapeutic agents.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c11-8(12)7-5-3-1-2-4-6(5)9-10-7/h1-4H2,(H,9,10)(H,11,12)
SMILES:C1CCc2c(C1)c(C(=O)O)n[nH]2
Synonyms:- 1H-Indazole-3-carboxylic acid, 4,5,6,7-tetrahydro-
- 2H-Indazole-3-carboxylic acid, 4,5,6,7-tetrahydro-
- 4,5,6,7-tetrahydro-2H-indazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.